C10H10F5N — CID 171224083
(1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 171224083) has the molecular formula C10H10F5N and a molecular weight of 239.19 g/mol. Its IUPAC name is (1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | (1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 171224083 |
| Molecular Formula | C10H10F5N |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | N[C@@H](CCC(F)(F)F)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H10F5N/c11-7-3-6(4-8(12)5-7)9(16)1-2-10(13,14)15/h3-5,9H,1-2,16H2/t9-/m0/s1 |
| InChIKey | UKXFGZIBEMAEQQ-VIFPVBQESA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |