C10H15FN2 — CID 171218658
(1S)-1-(3-fluorophenyl)butane-1,4-diamine (PubChem CID 171218658) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is (1S)-1-(3-fluorophenyl)butane-1,4-diamine.
| Compound Name | (1S)-1-(3-fluorophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171218658 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (1S)-1-(3-fluorophenyl)butane-1,4-diamine |
| SMILES | NCCC[C@H](N)c1cccc(F)c1 |
| InChI | InChI=1S/C10H15FN2/c11-9-4-1-3-8(7-9)10(13)5-2-6-12/h1,3-4,7,10H,2,5-6,12-13H2/t10-/m0/s1 |
| InChIKey | CQZSQSWLOAOYAO-JTQLQIEISA-N |
| XLogP | 1.56 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |