C13H16FN — CID 129395522
(1S)-1-(3-fluorophenyl)hepta-5,6-dien-1-amine (PubChem CID 129395522) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is (1S)-1-(3-fluorophenyl)hepta-5,6-dien-1-amine.
| Compound Name | (1S)-1-(3-fluorophenyl)hepta-5,6-dien-1-amine |
|---|---|
| PubChem CID | 129395522 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (1S)-1-(3-fluorophenyl)hepta-5,6-dien-1-amine |
| SMILES | C=C=CCCC[C@H](N)c1cccc(F)c1 |
| InChI | InChI=1S/C13H16FN/c1-2-3-4-5-9-13(15)11-7-6-8-12(14)10-11/h3,6-8,10,13H,1,4-5,9,15H2/t13-/m0/s1 |
| InChIKey | TUOQCKGPXFANEA-ZDUSSCGKSA-N |
| XLogP | 3.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|