C10H14FN — CID 78961002
(1S)-1-(3-fluorophenyl)butan-1-amine (PubChem CID 78961002) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is (1S)-1-(3-fluorophenyl)butan-1-amine.
| Compound Name | (1S)-1-(3-fluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 78961002 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (1S)-1-(3-fluorophenyl)butan-1-amine |
| SMILES | CCC[C@H](N)c1cccc(F)c1 |
| InChI | InChI=1S/C10H14FN/c1-2-4-10(12)8-5-3-6-9(11)7-8/h3,5-7,10H,2,4,12H2,1H3/t10-/m0/s1 |
| InChIKey | YVAAOXFAYOJLEF-JTQLQIEISA-N |
| XLogP | 2.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |