C10H15ClFN — CID 86262882
1-(3-fluorophenyl)butan-1-amine;hydrochloride (PubChem CID 86262882) has the molecular formula C10H15ClFN and a molecular weight of 203.69 g/mol. Its IUPAC name is 1-(3-fluorophenyl)butan-1-amine;hydrochloride.
| Compound Name | 1-(3-fluorophenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 86262882 |
| Molecular Formula | C10H15ClFN |
| Molecular Weight | 203.69 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1-(3-fluorophenyl)butan-1-amine;hydrochloride |
| SMILES | CCCC(N)c1cccc(F)c1.Cl |
| InChI | InChI=1S/C10H14FN.ClH/c1-2-4-10(12)8-5-3-6-9(11)7-8;/h3,5-7,10H,2,4,12H2,1H3;1H |
| InChIKey | PJACYMKJBXMKIA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |