C13H22N2 — CID 171231579
(1S)-1-(3-propan-2-ylphenyl)butane-1,4-diamine (PubChem CID 171231579) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (1S)-1-(3-propan-2-ylphenyl)butane-1,4-diamine.
| Compound Name | (1S)-1-(3-propan-2-ylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171231579 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (1S)-1-(3-propan-2-ylphenyl)butane-1,4-diamine |
| SMILES | CC(C)c1cccc([C@@H](N)CCCN)c1 |
| InChI | InChI=1S/C13H22N2/c1-10(2)11-5-3-6-12(9-11)13(15)7-4-8-14/h3,5-6,9-10,13H,4,7-8,14-15H2,1-2H3/t13-/m0/s1 |
| InChIKey | DLBFKADXUUEOBG-ZDUSSCGKSA-N |
| XLogP | 2.55 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |