C17H24 — CID 90744569
2-butyl-5-tert-butyl-1-ethynyl-3-methylbenzene (PubChem CID 90744569) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-butyl-5-tert-butyl-1-ethynyl-3-methylbenzene.
| Compound Name | 2-butyl-5-tert-butyl-1-ethynyl-3-methylbenzene |
|---|---|
| PubChem CID | 90744569 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2-butyl-5-tert-butyl-1-ethynyl-3-methylbenzene |
| SMILES | C#Cc1cc(C(C)(C)C)cc(C)c1CCCC |
| InChI | InChI=1S/C17H24/c1-7-9-10-16-13(3)11-15(17(4,5)6)12-14(16)8-2/h2,11-12H,7,9-10H2,1,3-6H3 |
| InChIKey | FWEOWZGGTWSVHE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|