C23H40 — CID 54311592
1,2,3,4-tetrabutyl-5-methylbenzene (PubChem CID 54311592) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is 1,2,3,4-tetrabutyl-5-methylbenzene.
| Compound Name | 1,2,3,4-tetrabutyl-5-methylbenzene |
|---|---|
| PubChem CID | 54311592 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | 1,2,3,4-tetrabutyl-5-methylbenzene |
| SMILES | CCCCc1cc(C)c(CCCC)c(CCCC)c1CCCC |
| InChI | InChI=1S/C23H40/c1-6-10-14-20-18-19(5)21(15-11-7-2)23(17-13-9-4)22(20)16-12-8-3/h18H,6-17H2,1-5H3 |
| InChIKey | SLGXTLLHAQYMPD-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |