C20H34 — CID 150402952
1,3,4-tributyl-2,5-dimethylbenzene (PubChem CID 150402952) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 1,3,4-tributyl-2,5-dimethylbenzene.
| Compound Name | 1,3,4-tributyl-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 150402952 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 1,3,4-tributyl-2,5-dimethylbenzene |
| SMILES | CCCCc1cc(C)c(CCCC)c(CCCC)c1C |
| InChI | InChI=1S/C20H34/c1-6-9-12-18-15-16(4)19(13-10-7-2)20(17(18)5)14-11-8-3/h15H,6-14H2,1-5H3 |
| InChIKey | HEDQWXGRFQXBKS-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |