C13H20O — CID 150949737
5-butyl-2,3,4-trimethylphenol (PubChem CID 150949737) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 5-butyl-2,3,4-trimethylphenol.
| Compound Name | 5-butyl-2,3,4-trimethylphenol |
|---|---|
| PubChem CID | 150949737 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 5-butyl-2,3,4-trimethylphenol |
| SMILES | CCCCc1cc(O)c(C)c(C)c1C |
| InChI | InChI=1S/C13H20O/c1-5-6-7-12-8-13(14)11(4)9(2)10(12)3/h8,14H,5-7H2,1-4H3 |
| InChIKey | LJVLTSYGNJDTOR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |