C20H34 — CID 150356555
1-decyl-2,3,4,5-tetramethylbenzene (PubChem CID 150356555) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 1-decyl-2,3,4,5-tetramethylbenzene.
| Compound Name | 1-decyl-2,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 150356555 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 1-decyl-2,3,4,5-tetramethylbenzene |
| SMILES | CCCCCCCCCCc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C20H34/c1-6-7-8-9-10-11-12-13-14-20-15-16(2)17(3)18(4)19(20)5/h15H,6-14H2,1-5H3 |
| InChIKey | GUVILXVCCOBQOZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|