C17H26 — CID 90895714
5-hexyl-4,7-dimethyl-2,3-dihydro-1H-indene (PubChem CID 90895714) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 5-hexyl-4,7-dimethyl-2,3-dihydro-1H-indene.
| Compound Name | 5-hexyl-4,7-dimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 90895714 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 5-hexyl-4,7-dimethyl-2,3-dihydro-1H-indene |
| SMILES | CCCCCCc1cc(C)c2c(c1C)CCC2 |
| InChI | InChI=1S/C17H26/c1-4-5-6-7-9-15-12-13(2)16-10-8-11-17(16)14(15)3/h12H,4-11H2,1-3H3 |
| InChIKey | VATJBUABNCOLAZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|