C15H21NS — CID 91133932
6-hexyl-4,7-dimethyl-1,3-benzothiazole (PubChem CID 91133932) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 6-hexyl-4,7-dimethyl-1,3-benzothiazole.
| Compound Name | 6-hexyl-4,7-dimethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 91133932 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 6-hexyl-4,7-dimethyl-1,3-benzothiazole |
| SMILES | CCCCCCc1cc(C)c2ncsc2c1C |
| InChI | InChI=1S/C15H21NS/c1-4-5-6-7-8-13-9-11(2)14-15(12(13)3)17-10-16-14/h9-10H,4-8H2,1-3H3 |
| InChIKey | YDTZTFPZIFVTLO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|