C16H26 — CID 90943000
1-heptyl-2,3,5-trimethylbenzene (PubChem CID 90943000) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1-heptyl-2,3,5-trimethylbenzene.
| Compound Name | 1-heptyl-2,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 90943000 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-heptyl-2,3,5-trimethylbenzene |
| SMILES | CCCCCCCc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C16H26/c1-5-6-7-8-9-10-16-12-13(2)11-14(3)15(16)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | XVYBQGMCJYLZJF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|