C12H21NS — CID 166842414
5-methyl-4-octyl-1,3-thiazole (PubChem CID 166842414) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 5-methyl-4-octyl-1,3-thiazole.
| Compound Name | 5-methyl-4-octyl-1,3-thiazole |
|---|---|
| PubChem CID | 166842414 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 5-methyl-4-octyl-1,3-thiazole |
| SMILES | CCCCCCCCc1ncsc1C |
| InChI | InChI=1S/C12H21NS/c1-3-4-5-6-7-8-9-12-11(2)14-10-13-12/h10H,3-9H2,1-2H3 |
| InChIKey | ZGGLOEYJDSAANY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|