C9H15NOS — CID 174918700
4-butyl-5-ethoxy-1,3-thiazole (PubChem CID 174918700) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 4-butyl-5-ethoxy-1,3-thiazole.
| Compound Name | 4-butyl-5-ethoxy-1,3-thiazole |
|---|---|
| PubChem CID | 174918700 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 4-butyl-5-ethoxy-1,3-thiazole |
| SMILES | CCCCc1ncsc1OCC |
| InChI | InChI=1S/C9H15NOS/c1-3-5-6-8-9(11-4-2)12-7-10-8/h7H,3-6H2,1-2H3 |
| InChIKey | LVHPONYCQFPWFC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |