C6H10N2OS — CID 117214392
4-(ethoxymethyl)-1,3-thiazol-5-amine (PubChem CID 117214392) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 4-(ethoxymethyl)-1,3-thiazol-5-amine.
| Compound Name | 4-(ethoxymethyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 117214392 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 4-(ethoxymethyl)-1,3-thiazol-5-amine |
| SMILES | CCOCc1ncsc1N |
| InChI | InChI=1S/C6H10N2OS/c1-2-9-3-5-6(7)10-4-8-5/h4H,2-3,7H2,1H3 |
| InChIKey | BMHFNKJWLKZREY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |