C6H11N3OS — CID 79765698
[5-(ethoxymethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 79765698) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is [5-(ethoxymethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(ethoxymethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79765698 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | [5-(ethoxymethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | CCOCc1cnc(NN)s1 |
| InChI | InChI=1S/C6H11N3OS/c1-2-10-4-5-3-8-6(9-7)11-5/h3H,2,4,7H2,1H3,(H,8,9) |
| InChIKey | KQBUSCNPASTFEK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|