C6H8F2N2OS — CID 82006742
5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-amine (PubChem CID 82006742) has the molecular formula C6H8F2N2OS and a molecular weight of 194.21 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82006742 |
| Molecular Formula | C6H8F2N2OS |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(COCC(F)F)s1 |
| InChI | InChI=1S/C6H8F2N2OS/c7-5(8)3-11-2-4-1-10-6(9)12-4/h1,5H,2-3H2,(H2,9,10) |
| InChIKey | UZURPZJFBKHJAT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |