C4H7N3S — CID 45076310
(5-methyl-1,3-thiazol-2-yl)hydrazine (PubChem CID 45076310) has the molecular formula C4H7N3S and a molecular weight of 129.19 g/mol. Its IUPAC name is (5-methyl-1,3-thiazol-2-yl)hydrazine.
| Compound Name | (5-methyl-1,3-thiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 45076310 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | (5-methyl-1,3-thiazol-2-yl)hydrazine |
| SMILES | Cc1cnc(NN)s1 |
| InChI | InChI=1S/C4H7N3S/c1-3-2-6-4(7-5)8-3/h2H,5H2,1H3,(H,6,7) |
| InChIKey | UXWBDFUFNAPNRZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|