C4H7N3S — CID 22064894
5-(aminomethyl)-1,3-thiazol-2-amine (PubChem CID 22064894) has the molecular formula C4H7N3S and a molecular weight of 129.19 g/mol. Its IUPAC name is 5-(aminomethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(aminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 22064894 |
| Molecular Formula | C4H7N3S |
| Molecular Weight | 129.19 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 5-(aminomethyl)-1,3-thiazol-2-amine |
| SMILES | NCc1cnc(N)s1 |
| InChI | InChI=1S/C4H7N3S/c5-1-3-2-7-4(6)8-3/h2H,1,5H2,(H2,6,7) |
| InChIKey | YVCRAVNZOVGDKJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |