C7H13N3OS — CID 105254368
[2-ethoxy-1-(1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 105254368) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is [2-ethoxy-1-(1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-ethoxy-1-(1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105254368 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | [2-ethoxy-1-(1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | CCOCC(NN)c1cscn1 |
| InChI | InChI=1S/C7H13N3OS/c1-2-11-3-6(10-8)7-4-12-5-9-7/h4-6,10H,2-3,8H2,1H3 |
| InChIKey | RSWKUXWVEUKBET-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|