C14H19N3S — CID 105254254
[2-(4-propan-2-ylphenyl)-1-(1,3-thiazol-4-yl)ethyl]hydrazine (PubChem CID 105254254) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is [2-(4-propan-2-ylphenyl)-1-(1,3-thiazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(4-propan-2-ylphenyl)-1-(1,3-thiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105254254 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | [2-(4-propan-2-ylphenyl)-1-(1,3-thiazol-4-yl)ethyl]hydrazine |
| SMILES | CC(C)c1ccc(CC(NN)c2cscn2)cc1 |
| InChI | InChI=1S/C14H19N3S/c1-10(2)12-5-3-11(4-6-12)7-13(17-15)14-8-18-9-16-14/h3-6,8-10,13,17H,7,15H2,1-2H3 |
| InChIKey | OKIHRXUYSIIMKH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|