C13H18N4S — CID 105297243
[2-(4-propan-2-ylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine (PubChem CID 105297243) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is [2-(4-propan-2-ylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-propan-2-ylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105297243 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [2-(4-propan-2-ylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
| SMILES | CC(C)c1ccc(CC(NN)c2cnsn2)cc1 |
| InChI | InChI=1S/C13H18N4S/c1-9(2)11-5-3-10(4-6-11)7-12(16-14)13-8-15-18-17-13/h3-6,8-9,12,16H,7,14H2,1-2H3 |
| InChIKey | SZKJODBAUOJZNO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|