C10H9BrF2N4S — CID 106271658
[2-(3-bromo-2,6-difluorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine (PubChem CID 106271658) has the molecular formula C10H9BrF2N4S and a molecular weight of 335.18 g/mol. Its IUPAC name is [2-(3-bromo-2,6-difluorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromo-2,6-difluorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106271658 |
| Molecular Formula | C10H9BrF2N4S |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | [2-(3-bromo-2,6-difluorophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1c(F)ccc(Br)c1F)c1cnsn1 |
| InChI | InChI=1S/C10H9BrF2N4S/c11-6-1-2-7(12)5(10(6)13)3-8(16-14)9-4-15-18-17-9/h1-2,4,8,16H,3,14H2 |
| InChIKey | QLEASTDGRSGWRO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|