C11H10BrF2N3S — CID 114167019
2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1,2,5-thiadiazol-3-yl)ethanamine (PubChem CID 114167019) has the molecular formula C11H10BrF2N3S and a molecular weight of 334.19 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1,2,5-thiadiazol-3-yl)ethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1,2,5-thiadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 114167019 |
| Molecular Formula | C11H10BrF2N3S |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(1,2,5-thiadiazol-3-yl)ethanamine |
| SMILES | CNC(Cc1c(F)ccc(Br)c1F)c1cnsn1 |
| InChI | InChI=1S/C11H10BrF2N3S/c1-15-9(10-5-16-18-17-10)4-6-8(13)3-2-7(12)11(6)14/h2-3,5,9,15H,4H2,1H3 |
| InChIKey | VVCLHGIOZQLIPZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|