C13H13BrF2N2S — CID 106274076
2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(2-methyl-1,3-thiazol-5-yl)ethanamine (PubChem CID 106274076) has the molecular formula C13H13BrF2N2S and a molecular weight of 347.23 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(2-methyl-1,3-thiazol-5-yl)ethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(2-methyl-1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 106274076 |
| Molecular Formula | C13H13BrF2N2S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-N-methyl-1-(2-methyl-1,3-thiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1c(F)ccc(Br)c1F)c1cnc(C)s1 |
| InChI | InChI=1S/C13H13BrF2N2S/c1-7-18-6-12(19-7)11(17-2)5-8-10(15)4-3-9(14)13(8)16/h3-4,6,11,17H,5H2,1-2H3 |
| InChIKey | JTDIHKLLKGCVJS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|