C14H15BrF2N2S — CID 106271793
[2-(3-bromo-2,6-difluorophenyl)-1-(5-ethylthiophen-2-yl)ethyl]hydrazine (PubChem CID 106271793) has the molecular formula C14H15BrF2N2S and a molecular weight of 361.26 g/mol. Its IUPAC name is [2-(3-bromo-2,6-difluorophenyl)-1-(5-ethylthiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromo-2,6-difluorophenyl)-1-(5-ethylthiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106271793 |
| Molecular Formula | C14H15BrF2N2S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | [2-(3-bromo-2,6-difluorophenyl)-1-(5-ethylthiophen-2-yl)ethyl]hydrazine |
| SMILES | CCc1ccc(C(Cc2c(F)ccc(Br)c2F)NN)s1 |
| InChI | InChI=1S/C14H15BrF2N2S/c1-2-8-3-6-13(20-8)12(19-18)7-9-11(16)5-4-10(15)14(9)17/h3-6,12,19H,2,7,18H2,1H3 |
| InChIKey | SNDARZHGEROZBJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|