C16H15BrF2IN — CID 106274245
2-(3-bromo-2,6-difluorophenyl)-1-(2-iodo-3-methylphenyl)-N-methylethanamine (PubChem CID 106274245) has the molecular formula C16H15BrF2IN and a molecular weight of 466.11 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(2-iodo-3-methylphenyl)-N-methylethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2-iodo-3-methylphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 106274245 |
| Molecular Formula | C16H15BrF2IN |
| Molecular Weight | 466.11 g/mol |
| Exact Mass | 464.94 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2-iodo-3-methylphenyl)-N-methylethanamine |
| SMILES | CNC(Cc1c(F)ccc(Br)c1F)c1cccc(C)c1I |
| InChI | InChI=1S/C16H15BrF2IN/c1-9-4-3-5-10(16(9)20)14(21-2)8-11-13(18)7-6-12(17)15(11)19/h3-7,14,21H,8H2,1-2H3 |
| InChIKey | QFGGELBDLLESTF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.11 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|