C13H15BrF2N4 — CID 106268168
N-[2-(3-bromo-2,6-difluorophenyl)-1-(2H-triazol-4-yl)ethyl]propan-1-amine (PubChem CID 106268168) has the molecular formula C13H15BrF2N4 and a molecular weight of 345.19 g/mol. Its IUPAC name is N-[2-(3-bromo-2,6-difluorophenyl)-1-(2H-triazol-4-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(3-bromo-2,6-difluorophenyl)-1-(2H-triazol-4-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106268168 |
| Molecular Formula | C13H15BrF2N4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-[2-(3-bromo-2,6-difluorophenyl)-1-(2H-triazol-4-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1c(F)ccc(Br)c1F)c1cn[nH]n1 |
| InChI | InChI=1S/C13H15BrF2N4/c1-2-5-17-11(12-7-18-20-19-12)6-8-10(15)4-3-9(14)13(8)16/h3-4,7,11,17H,2,5-6H2,1H3,(H,18,19,20) |
| InChIKey | YHYFHOMJBAJQMB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|