C12H14F2N4 — CID 82922839
2-(3,4-difluorophenyl)-N-ethyl-1-(2H-triazol-4-yl)ethanamine (PubChem CID 82922839) has the molecular formula C12H14F2N4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-ethyl-1-(2H-triazol-4-yl)ethanamine.
| Compound Name | 2-(3,4-difluorophenyl)-N-ethyl-1-(2H-triazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 82922839 |
| Molecular Formula | C12H14F2N4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-ethyl-1-(2H-triazol-4-yl)ethanamine |
| SMILES | CCNC(Cc1ccc(F)c(F)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C12H14F2N4/c1-2-15-11(12-7-16-18-17-12)6-8-3-4-9(13)10(14)5-8/h3-5,7,11,15H,2,6H2,1H3,(H,16,17,18) |
| InChIKey | BZNQLMLVIRUKIM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |