C10H11BrN4S — CID 105284531
[2-(3-bromophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine (PubChem CID 105284531) has the molecular formula C10H11BrN4S and a molecular weight of 299.20 g/mol. Its IUPAC name is [2-(3-bromophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3-bromophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105284531 |
| Molecular Formula | C10H11BrN4S |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | [2-(3-bromophenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(Br)c1)c1cnsn1 |
| InChI | InChI=1S/C10H11BrN4S/c11-8-3-1-2-7(4-8)5-9(14-12)10-6-13-16-15-10/h1-4,6,9,14H,5,12H2 |
| InChIKey | WFSWCRITLJMLQA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|