C7H9N5S2 — CID 105331988
[1-(1,2,5-thiadiazol-3-yl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105331988) has the molecular formula C7H9N5S2 and a molecular weight of 227.32 g/mol. Its IUPAC name is [1-(1,2,5-thiadiazol-3-yl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(1,2,5-thiadiazol-3-yl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105331988 |
| Molecular Formula | C7H9N5S2 |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | [1-(1,2,5-thiadiazol-3-yl)-2-(1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cncs1)c1cnsn1 |
| InChI | InChI=1S/C7H9N5S2/c8-11-6(7-3-10-14-12-7)1-5-2-9-4-13-5/h2-4,6,11H,1,8H2 |
| InChIKey | WJKDBXGKRGWVFE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|