C7H12N4S — CID 105311515
1-(1,2,5-thiadiazol-3-yl)pent-4-enylhydrazine (PubChem CID 105311515) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 1-(1,2,5-thiadiazol-3-yl)pent-4-enylhydrazine.
| Compound Name | 1-(1,2,5-thiadiazol-3-yl)pent-4-enylhydrazine |
|---|---|
| PubChem CID | 105311515 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-(1,2,5-thiadiazol-3-yl)pent-4-enylhydrazine |
| SMILES | C=CCCC(NN)c1cnsn1 |
| InChI | InChI=1S/C7H12N4S/c1-2-3-4-6(10-8)7-5-9-12-11-7/h2,5-6,10H,1,3-4,8H2 |
| InChIKey | ZSYYMHIMGIGHQD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|