C11H14N4S — CID 105284217
[2-(4-methylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine (PubChem CID 105284217) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-methylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105284217 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [2-(4-methylphenyl)-1-(1,2,5-thiadiazol-3-yl)ethyl]hydrazine |
| SMILES | Cc1ccc(CC(NN)c2cnsn2)cc1 |
| InChI | InChI=1S/C11H14N4S/c1-8-2-4-9(5-3-8)6-10(14-12)11-7-13-16-15-11/h2-5,7,10,14H,6,12H2,1H3 |
| InChIKey | XZOJOULPLOEMCV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|