C15H22N4 — CID 105258011
[1-(1-methylimidazol-2-yl)-2-(4-propan-2-ylphenyl)ethyl]hydrazine (PubChem CID 105258011) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is [1-(1-methylimidazol-2-yl)-2-(4-propan-2-ylphenyl)ethyl]hydrazine.
| Compound Name | [1-(1-methylimidazol-2-yl)-2-(4-propan-2-ylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105258011 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | [1-(1-methylimidazol-2-yl)-2-(4-propan-2-ylphenyl)ethyl]hydrazine |
| SMILES | CC(C)c1ccc(CC(NN)c2nccn2C)cc1 |
| InChI | InChI=1S/C15H22N4/c1-11(2)13-6-4-12(5-7-13)10-14(18-16)15-17-8-9-19(15)3/h4-9,11,14,18H,10,16H2,1-3H3 |
| InChIKey | MZBWDZZVYQSFPL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|