C10H13BrN4S — CID 105258015
[2-(5-bromothiophen-2-yl)-1-(1-methylimidazol-2-yl)ethyl]hydrazine (PubChem CID 105258015) has the molecular formula C10H13BrN4S and a molecular weight of 301.21 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-1-(1-methylimidazol-2-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromothiophen-2-yl)-1-(1-methylimidazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105258015 |
| Molecular Formula | C10H13BrN4S |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-1-(1-methylimidazol-2-yl)ethyl]hydrazine |
| SMILES | Cn1ccnc1C(Cc1ccc(Br)s1)NN |
| InChI | InChI=1S/C10H13BrN4S/c1-15-5-4-13-10(15)8(14-12)6-7-2-3-9(11)16-7/h2-5,8,14H,6,12H2,1H3 |
| InChIKey | SDYAZSXDLSQIOZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|