C11H11Br2N3S — CID 105267616
[1-(5-bromo-2-pyridinyl)-2-(5-bromothiophen-2-yl)ethyl]hydrazine (PubChem CID 105267616) has the molecular formula C11H11Br2N3S and a molecular weight of 377.11 g/mol. Its IUPAC name is [1-(5-bromo-2-pyridinyl)-2-(5-bromothiophen-2-yl)ethyl]hydrazine.
| Compound Name | [1-(5-bromo-2-pyridinyl)-2-(5-bromothiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105267616 |
| Molecular Formula | C11H11Br2N3S |
| Molecular Weight | 377.11 g/mol |
| Exact Mass | 374.90 |
| IUPAC Name | [1-(5-bromo-2-pyridinyl)-2-(5-bromothiophen-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)s1)c1ccc(Br)cn1 |
| InChI | InChI=1S/C11H11Br2N3S/c12-7-1-3-9(15-6-7)10(16-14)5-8-2-4-11(13)17-8/h1-4,6,10,16H,5,14H2 |
| InChIKey | ZTKZJRWLEBXQAX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|