C9H12BrN5S — CID 105231023
4-[2-(5-bromothiophen-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine (PubChem CID 105231023) has the molecular formula C9H12BrN5S and a molecular weight of 302.20 g/mol. Its IUPAC name is 4-[2-(5-bromothiophen-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[2-(5-bromothiophen-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231023 |
| Molecular Formula | C9H12BrN5S |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 4-[2-(5-bromothiophen-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
| SMILES | NNC(Cc1ccc(Br)s1)c1cn[nH]c1N |
| InChI | InChI=1S/C9H12BrN5S/c10-8-2-1-5(16-8)3-7(14-12)6-4-13-15-9(6)11/h1-2,4,7,14H,3,12H2,(H3,11,13,15) |
| InChIKey | LGYNBQLSUQCEAV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|