C11H13BrFN5 — CID 105231120
4-[2-(2-bromo-4-fluorophenyl)-1-hydrazinylethyl]-1H-pyrazol-5-amine (PubChem CID 105231120) has the molecular formula C11H13BrFN5 and a molecular weight of 314.16 g/mol. Its IUPAC name is 4-[2-(2-bromo-4-fluorophenyl)-1-hydrazinylethyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[2-(2-bromo-4-fluorophenyl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231120 |
| Molecular Formula | C11H13BrFN5 |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 4-[2-(2-bromo-4-fluorophenyl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
| SMILES | NNC(Cc1ccc(F)cc1Br)c1cn[nH]c1N |
| InChI | InChI=1S/C11H13BrFN5/c12-9-4-7(13)2-1-6(9)3-10(17-15)8-5-16-18-11(8)14/h1-2,4-5,10,17H,3,15H2,(H3,14,16,18) |
| InChIKey | OLGCVRVMVSNQJI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|