C10H10BrFN4S — CID 105296596
[2-(2-bromo-4-fluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine (PubChem CID 105296596) has the molecular formula C10H10BrFN4S and a molecular weight of 317.19 g/mol. Its IUPAC name is [2-(2-bromo-4-fluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2-bromo-4-fluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105296596 |
| Molecular Formula | C10H10BrFN4S |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | [2-(2-bromo-4-fluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1Br)c1cnns1 |
| InChI | InChI=1S/C10H10BrFN4S/c11-8-4-7(12)2-1-6(8)3-9(15-13)10-5-14-16-17-10/h1-2,4-5,9,15H,3,13H2 |
| InChIKey | RSSFXKRZGIVNOS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|