C10H10F2N4S — CID 105297891
[2-(2,3-difluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine (PubChem CID 105297891) has the molecular formula C10H10F2N4S and a molecular weight of 256.28 g/mol. Its IUPAC name is [2-(2,3-difluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2,3-difluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105297891 |
| Molecular Formula | C10H10F2N4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | [2-(2,3-difluorophenyl)-1-(thiadiazol-5-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(F)c1F)c1cnns1 |
| InChI | InChI=1S/C10H10F2N4S/c11-7-3-1-2-6(10(7)12)4-8(15-13)9-5-14-16-17-9/h1-3,5,8,15H,4,13H2 |
| InChIKey | YYWNWWJXYUULQV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|