C9H10F4N2 — CID 105265224
[3-(2,3-difluorophenyl)-1,1-difluoropropan-2-yl]hydrazine (PubChem CID 105265224) has the molecular formula C9H10F4N2 and a molecular weight of 222.19 g/mol. Its IUPAC name is [3-(2,3-difluorophenyl)-1,1-difluoropropan-2-yl]hydrazine.
| Compound Name | [3-(2,3-difluorophenyl)-1,1-difluoropropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105265224 |
| Molecular Formula | C9H10F4N2 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | [3-(2,3-difluorophenyl)-1,1-difluoropropan-2-yl]hydrazine |
| SMILES | NNC(Cc1cccc(F)c1F)C(F)F |
| InChI | InChI=1S/C9H10F4N2/c10-6-3-1-2-5(8(6)11)4-7(15-14)9(12)13/h1-3,7,9,15H,4,14H2 |
| InChIKey | WRVPRJTUMKHCIR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|