C15H22F2N2 — CID 105296152
[1-cyclohexyl-3-(2,3-difluorophenyl)propan-2-yl]hydrazine (PubChem CID 105296152) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is [1-cyclohexyl-3-(2,3-difluorophenyl)propan-2-yl]hydrazine.
| Compound Name | [1-cyclohexyl-3-(2,3-difluorophenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105296152 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [1-cyclohexyl-3-(2,3-difluorophenyl)propan-2-yl]hydrazine |
| SMILES | NNC(Cc1cccc(F)c1F)CC1CCCCC1 |
| InChI | InChI=1S/C15H22F2N2/c16-14-8-4-7-12(15(14)17)10-13(19-18)9-11-5-2-1-3-6-11/h4,7-8,11,13,19H,1-3,5-6,9-10,18H2 |
| InChIKey | KMLKURRUBADMNK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|