C11H13BrN4S — CID 105260361
[2-(5-bromothiophen-2-yl)-1-(2-methylpyrimidin-4-yl)ethyl]hydrazine (PubChem CID 105260361) has the molecular formula C11H13BrN4S and a molecular weight of 313.22 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-1-(2-methylpyrimidin-4-yl)ethyl]hydrazine.
| Compound Name | [2-(5-bromothiophen-2-yl)-1-(2-methylpyrimidin-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105260361 |
| Molecular Formula | C11H13BrN4S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-1-(2-methylpyrimidin-4-yl)ethyl]hydrazine |
| SMILES | Cc1nccc(C(Cc2ccc(Br)s2)NN)n1 |
| InChI | InChI=1S/C11H13BrN4S/c1-7-14-5-4-9(15-7)10(16-13)6-8-2-3-11(12)17-8/h2-5,10,16H,6,13H2,1H3 |
| InChIKey | YNPVVHYAYJOEBZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|