C8H14N8 — CID 107066330
[1-(1-methylimidazol-2-yl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine (PubChem CID 107066330) has the molecular formula C8H14N8 and a molecular weight of 222.26 g/mol. Its IUPAC name is [1-(1-methylimidazol-2-yl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(1-methylimidazol-2-yl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066330 |
| Molecular Formula | C8H14N8 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | [1-(1-methylimidazol-2-yl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
| SMILES | Cn1nnc(CC(NN)c2nccn2C)n1 |
| InChI | InChI=1S/C8H14N8/c1-15-4-3-10-8(15)6(11-9)5-7-12-14-16(2)13-7/h3-4,6,11H,5,9H2,1-2H3 |
| InChIKey | FKHAJPYAPYVKBN-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|