C6H11N9 — CID 107066305
[2-(2-methyltetrazol-5-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine (PubChem CID 107066305) has the molecular formula C6H11N9 and a molecular weight of 209.22 g/mol. Its IUPAC name is [2-(2-methyltetrazol-5-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(2-methyltetrazol-5-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066305 |
| Molecular Formula | C6H11N9 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | [2-(2-methyltetrazol-5-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine |
| SMILES | Cn1nnc(CC(NN)c2cn[nH]n2)n1 |
| InChI | InChI=1S/C6H11N9/c1-15-12-6(11-14-15)2-4(9-7)5-3-8-13-10-5/h3-4,9H,2,7H2,1H3,(H,8,10,13) |
| InChIKey | RAWIOTQNWJRWEN-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|