C10H12Br2N6 — CID 107066786
[1-(2,5-dibromophenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine (PubChem CID 107066786) has the molecular formula C10H12Br2N6 and a molecular weight of 376.06 g/mol. Its IUPAC name is [1-(2,5-dibromophenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(2,5-dibromophenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066786 |
| Molecular Formula | C10H12Br2N6 |
| Molecular Weight | 376.06 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | [1-(2,5-dibromophenyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
| SMILES | Cn1nnc(CC(NN)c2cc(Br)ccc2Br)n1 |
| InChI | InChI=1S/C10H12Br2N6/c1-18-16-10(15-17-18)5-9(14-13)7-4-6(11)2-3-8(7)12/h2-4,9,14H,5,13H2,1H3 |
| InChIKey | MHSFQSINGXWDBC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.06 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|