C9H12FN7 — CID 107066996
[1-(5-fluoro-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine (PubChem CID 107066996) has the molecular formula C9H12FN7 and a molecular weight of 237.24 g/mol. Its IUPAC name is [1-(5-fluoro-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(5-fluoro-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066996 |
| Molecular Formula | C9H12FN7 |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | [1-(5-fluoro-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
| SMILES | Cn1nnc(CC(NN)c2cncc(F)c2)n1 |
| InChI | InChI=1S/C9H12FN7/c1-17-15-9(14-16-17)3-8(13-11)6-2-7(10)5-12-4-6/h2,4-5,8,13H,3,11H2,1H3 |
| InChIKey | HSBVDQHARQHYFZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|