C11H14F2N6O — CID 107066949
[1-[3-(difluoromethoxy)phenyl]-2-(2-methyltetrazol-5-yl)ethyl]hydrazine (PubChem CID 107066949) has the molecular formula C11H14F2N6O and a molecular weight of 284.27 g/mol. Its IUPAC name is [1-[3-(difluoromethoxy)phenyl]-2-(2-methyltetrazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-[3-(difluoromethoxy)phenyl]-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066949 |
| Molecular Formula | C11H14F2N6O |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [1-[3-(difluoromethoxy)phenyl]-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
| SMILES | Cn1nnc(CC(NN)c2cccc(OC(F)F)c2)n1 |
| InChI | InChI=1S/C11H14F2N6O/c1-19-17-10(16-18-19)6-9(15-14)7-3-2-4-8(5-7)20-11(12)13/h2-5,9,11,15H,6,14H2,1H3 |
| InChIKey | AYVAYWIZMKZVPE-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|